C22H36O2 — CID 101436405
(1R,7S,7aR)-3,3-bis(methoxymethyl)-1-methyl-7-[(Z)-oct-1-en-3-ynyl]-1,2,3a,4,5,6,7,7a-octahydroindene (PubChem CID 101436405) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (1R,7S,7aR)-3,3-bis(methoxymethyl)-1-methyl-7-[(Z)-oct-1-en-3-ynyl]-1,2,3a,4,5,6,7,7a-octahydroindene.
| Compound Name | (1R,7S,7aR)-3,3-bis(methoxymethyl)-1-methyl-7-[(Z)-oct-1-en-3-ynyl]-1,2,3a,4,5,6,7,7a-octahydroindene |
|---|---|
| PubChem CID | 101436405 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (1R,7S,7aR)-3,3-bis(methoxymethyl)-1-methyl-7-[(Z)-oct-1-en-3-ynyl]-1,2,3a,4,5,6,7,7a-octahydroindene |
| SMILES | CCCCC#C/C=C\[C@@H]1CCCC2[C@@H]1[C@H](C)CC2(COC)COC |
| InChI | InChI=1S/C22H36O2/c1-5-6-7-8-9-10-12-19-13-11-14-20-21(19)18(2)15-22(20,16-23-3)17-24-4/h10,12,18-21H,5-7,11,13-17H2,1-4H3/b12-10-/t18-,19-,20?,21-/m1/s1 |
| InChIKey | LIRVUGLQDZALKE-ZERYJPFRSA-N |
| XLogP | 5.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|