C12H18OSe — CID 101436535
(2S)-3,3-dimethyl-2-phenylselanylbutan-1-ol (PubChem CID 101436535) has the molecular formula C12H18OSe and a molecular weight of 257.23 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-phenylselanylbutan-1-ol.
| Compound Name | (2S)-3,3-dimethyl-2-phenylselanylbutan-1-ol |
|---|---|
| PubChem CID | 101436535 |
| Molecular Formula | C12H18OSe |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (2S)-3,3-dimethyl-2-phenylselanylbutan-1-ol |
| SMILES | CC(C)(C)[C@@H](CO)[Se]c1ccccc1 |
| InChI | InChI=1S/C12H18OSe/c1-12(2,3)11(9-13)14-10-7-5-4-6-8-10/h4-8,11,13H,9H2,1-3H3/t11-/m1/s1 |
| InChIKey | KPBOUQXRRPUSDU-LLVKDONJSA-N |
| XLogP | 1.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|