C20H12N4O2 — CID 101436702
9-(4-nitrophenyl)-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene (PubChem CID 101436702) has the molecular formula C20H12N4O2 and a molecular weight of 340.34 g/mol. Its IUPAC name is 9-(4-nitrophenyl)-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene.
| Compound Name | 9-(4-nitrophenyl)-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
|---|---|
| PubChem CID | 101436702 |
| Molecular Formula | C20H12N4O2 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 9-(4-nitrophenyl)-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3ccccc3c3nc4ccccn4c23)cc1 |
| InChI | InChI=1S/C20H12N4O2/c25-24(26)14-10-8-13(9-11-14)18-20-19(15-5-1-2-6-16(15)21-18)22-17-7-3-4-12-23(17)20/h1-12H |
| InChIKey | RIRCHQVKCPCGTP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|