C22H28O5 — CID 101436868
(1S,9S,10S)-9-butanoyl-10-cyclohexyloxy-1-methoxy-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one (PubChem CID 101436868) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (1S,9S,10S)-9-butanoyl-10-cyclohexyloxy-1-methoxy-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one.
| Compound Name | (1S,9S,10S)-9-butanoyl-10-cyclohexyloxy-1-methoxy-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 101436868 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (1S,9S,10S)-9-butanoyl-10-cyclohexyloxy-1-methoxy-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
| SMILES | CCCC(=O)[C@@]12O[C@@](OC)(C[C@@H]1OC1CCCCC1)c1ccccc1C2=O |
| InChI | InChI=1S/C22H28O5/c1-3-9-18(23)22-19(26-15-10-5-4-6-11-15)14-21(25-2,27-22)17-13-8-7-12-16(17)20(22)24/h7-8,12-13,15,19H,3-6,9-11,14H2,1-2H3/t19-,21-,22+/m0/s1 |
| InChIKey | AHYVGJBVDARGLM-ILWGZMRPSA-N |
| XLogP | 3.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|