C23H30O5 — CID 101436870
(1S,9S,10S)-10-cyclohexyloxy-1-methoxy-9-pentanoyl-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one (PubChem CID 101436870) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (1S,9S,10S)-10-cyclohexyloxy-1-methoxy-9-pentanoyl-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one.
| Compound Name | (1S,9S,10S)-10-cyclohexyloxy-1-methoxy-9-pentanoyl-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 101436870 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (1S,9S,10S)-10-cyclohexyloxy-1-methoxy-9-pentanoyl-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
| SMILES | CCCCC(=O)[C@@]12O[C@@](OC)(C[C@@H]1OC1CCCCC1)c1ccccc1C2=O |
| InChI | InChI=1S/C23H30O5/c1-3-4-14-19(24)23-20(27-16-10-6-5-7-11-16)15-22(26-2,28-23)18-13-9-8-12-17(18)21(23)25/h8-9,12-13,16,20H,3-7,10-11,14-15H2,1-2H3/t20-,22-,23+/m0/s1 |
| InChIKey | TZODNVIYKJQVPV-ACIOBRDBSA-N |
| XLogP | 4.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|