C15H26O2 — CID 101437097
(4aS,6R,7S)-4,4,4a,7-tetramethyl-1,2,3,5,6,8-hexahydrobenzo[7]annulene-6,7-diol (PubChem CID 101437097) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (4aS,6R,7S)-4,4,4a,7-tetramethyl-1,2,3,5,6,8-hexahydrobenzo[7]annulene-6,7-diol.
| Compound Name | (4aS,6R,7S)-4,4,4a,7-tetramethyl-1,2,3,5,6,8-hexahydrobenzo[7]annulene-6,7-diol |
|---|---|
| PubChem CID | 101437097 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (4aS,6R,7S)-4,4,4a,7-tetramethyl-1,2,3,5,6,8-hexahydrobenzo[7]annulene-6,7-diol |
| SMILES | CC1(C)CCCC2=CC[C@](C)(O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C15H26O2/c1-13(2)8-5-6-11-7-9-15(4,17)12(16)10-14(11,13)3/h7,12,16-17H,5-6,8-10H2,1-4H3/t12-,14-,15+/m1/s1 |
| InChIKey | CNBXXCQPWFOWPO-YUELXQCFSA-N |
| XLogP | 3.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|