C36H46N4O2 — CID 101437201
(1R,2R,4R,5Z,12R,13S)-25-(8-hydroxy-9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,25-dien-13-ol (PubChem CID 101437201) has the molecular formula C36H46N4O2 and a molecular weight of 566.79 g/mol. Its IUPAC name is (1R,2R,4R,5Z,12R,13S)-25-(8-hydroxy-9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,25-dien-13-ol.
| Compound Name | (1R,2R,4R,5Z,12R,13S)-25-(8-hydroxy-9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,25-dien-13-ol |
|---|---|
| PubChem CID | 101437201 |
| Molecular Formula | C36H46N4O2 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | (1R,2R,4R,5Z,12R,13S)-25-(8-hydroxy-9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,25-dien-13-ol |
| SMILES | Oc1cccc2c1[nH]c1c(C3=C[C@@]4(O)CCCCCCCCN5CC[C@@H]3[C@]3(C[C@@H]6/C=C\CCCCN6[C@H]34)C5)nccc12 |
| InChI | InChI=1S/C36H46N4O2/c41-30-14-11-13-26-27-15-18-37-32(33(27)38-31(26)30)28-23-36(42)17-8-4-1-2-5-9-19-39-21-16-29(28)35(24-39)22-25-12-7-3-6-10-20-40(25)34(35)36/h7,11-15,18,23,25,29,34,38,41-42H,1-6,8-10,16-17,19-22,24H2/b12-7-/t25-,29-,34+,35-,36-/m0/s1 |
| InChIKey | ZEYPLHXZPVOOLS-CJDFJJMZSA-N |
| XLogP | 6.79 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|