About CID 101437421
CID 101437421 (PubChem CID 101437421) has the molecular formula C19H17N2
and a molecular weight of 273.36 g/mol.
Molecular Properties
| Compound Name | CID 101437421 |
| PubChem CID | 101437421 |
| Molecular Formula | C19H17N2 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | — |
| SMILES | [CH](CCc1ccc(-c2ccccn2)nc1)c1ccccc1 |
| InChI | InChI=1S/C19H17N2/c1-2-7-16(8-3-1)9-6-10-17-12-13-19(21-15-17)18-11-4-5-14-20-18/h1-5,7-9,11-15H,6,10H2 |
| InChIKey | IZECRBJMSHIZIK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 101437421 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101437421?
The IUPAC name of CID 101437421 (CID 101437421) is not available.
What is the SMILES notation for CID 101437421?
The canonical SMILES for CID 101437421 is [CH](CCc1ccc(-c2ccccn2)nc1)c1ccccc1.
What is the InChIKey of CID 101437421?
The InChIKey is IZECRBJMSHIZIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N2/c1-2-7-16(8-3-1)9-6-10-17-12-13-19(21-15-17)18-11-4-5-14-20-18/h1-5,7-9,11-15H,6,10H2.
What are the key properties of CID 101437421?
CID 101437421 has a molecular weight of 273.36 g/mol, XLogP of 4.33, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101437421 is sourced from PubChem (CID 101437421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).