C68H100Si2 — CID 101437931
(E)-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)-[(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)-phenylsilylidene]-phenylsilane (PubChem CID 101437931) has the molecular formula C68H100Si2 and a molecular weight of 973.72 g/mol. Its IUPAC name is (E)-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)-[(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)-phenylsilylidene]-phenylsilane.
| Compound Name | (E)-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)-[(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)-phenylsilylidene]-phenylsilane |
|---|---|
| PubChem CID | 101437931 |
| Molecular Formula | C68H100Si2 |
| Molecular Weight | 973.72 g/mol |
| Exact Mass | 972.74 |
| IUPAC Name | (E)-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)-[(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)-phenylsilylidene]-phenylsilane |
| SMILES | CCC1(CC)CC(CC)(CC)c2c1cc1c(c2/[Si](c2ccccc2)=[Si](\c2ccccc2)c2c3c(cc4c2C(CC)(CC)CC4(CC)CC)C(CC)(CC)CC3(CC)CC)C(CC)(CC)CC1(CC)CC |
| InChI | InChI=1S/C68H100Si2/c1-17-61(18-2)45-65(25-9,26-10)55-51(61)43-52-56(66(27-11,28-12)46-62(52,19-3)20-4)59(55)69(49-39-35-33-36-40-49)70(50-41-37-34-38-42-50)60-57-53(63(21-5,22-6)47-67(57,29-13)30-14)44-54-58(60)68(31-15,32-16)48-64(54,23-7)24-8/h33-44H,17-32,45-48H2,1-16H3/b70-69+ |
| InChIKey | QCURHVYYWCIGCX-QNRHEQFBSA-N |
| XLogP | 16.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.72 |
| LogP ≤ 5 | 16.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|