C15H22O4 — CID 101437947
(3R,3aR,5aR,9S,9aR,9bS)-3a-hydroxy-3,9,9a-trimethyl-3,5,5a,6,7,8,9,9b-octahydrobenzo[g][1]benzofuran-2,4-dione (PubChem CID 101437947) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (3R,3aR,5aR,9S,9aR,9bS)-3a-hydroxy-3,9,9a-trimethyl-3,5,5a,6,7,8,9,9b-octahydrobenzo[g][1]benzofuran-2,4-dione.
| Compound Name | (3R,3aR,5aR,9S,9aR,9bS)-3a-hydroxy-3,9,9a-trimethyl-3,5,5a,6,7,8,9,9b-octahydrobenzo[g][1]benzofuran-2,4-dione |
|---|---|
| PubChem CID | 101437947 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (3R,3aR,5aR,9S,9aR,9bS)-3a-hydroxy-3,9,9a-trimethyl-3,5,5a,6,7,8,9,9b-octahydrobenzo[g][1]benzofuran-2,4-dione |
| SMILES | C[C@H]1C(=O)O[C@@H]2[C@@]1(O)C(=O)C[C@H]1CCC[C@H](C)[C@]12C |
| InChI | InChI=1S/C15H22O4/c1-8-5-4-6-10-7-11(16)15(18)9(2)12(17)19-13(15)14(8,10)3/h8-10,13,18H,4-7H2,1-3H3/t8-,9-,10+,13-,14+,15-/m0/s1 |
| InChIKey | UBYUNTMRNPBFEF-NCQMRKNVSA-N |
| XLogP | 1.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |