C16H10FNO3 — CID 101438443
2-(2-fluoro-4-methylphenyl)isoquinoline-1,3,4-trione (PubChem CID 101438443) has the molecular formula C16H10FNO3 and a molecular weight of 283.26 g/mol. Its IUPAC name is 2-(2-fluoro-4-methylphenyl)isoquinoline-1,3,4-trione.
| Compound Name | 2-(2-fluoro-4-methylphenyl)isoquinoline-1,3,4-trione |
|---|---|
| PubChem CID | 101438443 |
| Molecular Formula | C16H10FNO3 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-(2-fluoro-4-methylphenyl)isoquinoline-1,3,4-trione |
| SMILES | Cc1ccc(N2C(=O)C(=O)c3ccccc3C2=O)c(F)c1 |
| InChI | InChI=1S/C16H10FNO3/c1-9-6-7-13(12(17)8-9)18-15(20)11-5-3-2-4-10(11)14(19)16(18)21/h2-8H,1H3 |
| InChIKey | GTQBIHILHDVKSB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|