About 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate
1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 101438462) has the molecular formula C15H16O4
and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate.
Molecular Properties
| Compound Name | 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate |
| PubChem CID | 101438462 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | C#CCOC(=O)C1(C(=O)OCC(=C)C=C)CC=CC1 |
| InChI | InChI=1S/C15H16O4/c1-4-10-18-13(16)15(8-6-7-9-15)14(17)19-11-12(3)5-2/h1,5-7H,2-3,8-11H2 |
| InChIKey | NXUVJJUHLOMXMO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate?
The IUPAC name of 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate (CID 101438462) is 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate.
What is the SMILES notation for 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate?
The canonical SMILES for 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate is C#CCOC(=O)C1(C(=O)OCC(=C)C=C)CC=CC1.
What is the InChIKey of 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate?
The InChIKey is NXUVJJUHLOMXMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O4/c1-4-10-18-13(16)15(8-6-7-9-15)14(17)19-11-12(3)5-2/h1,5-7H,2-3,8-11H2.
What are the key properties of 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate?
1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate has a molecular weight of 260.29 g/mol, XLogP of 1.78, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O'-(2-methylidenebut-3-enyl) 1-O-prop-2-ynyl cyclopent-3-ene-1,1-dicarboxylate is sourced from PubChem (CID 101438462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).