About 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one
5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one (PubChem CID 101438715) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one.
Molecular Properties
| Compound Name | 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one |
| PubChem CID | 101438715 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one |
| SMILES | CCC(=O)CC(C)(C)C1=CCC=C1 |
| InChI | InChI=1S/C12H18O/c1-4-11(13)9-12(2,3)10-7-5-6-8-10/h5,7-8H,4,6,9H2,1-3H3 |
| InChIKey | JFHZMKZBSNWZNR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one?
The IUPAC name of 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one (CID 101438715) is 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one.
What is the SMILES notation for 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one?
The canonical SMILES for 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one is CCC(=O)CC(C)(C)C1=CCC=C1.
What is the InChIKey of 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one?
The InChIKey is JFHZMKZBSNWZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-4-11(13)9-12(2,3)10-7-5-6-8-10/h5,7-8H,4,6,9H2,1-3H3.
What are the key properties of 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one?
5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one has a molecular weight of 178.27 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopenta-1,4-dien-1-yl-5-methylhexan-3-one is sourced from PubChem (CID 101438715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).