About [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid
[[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid (PubChem CID 10143920) has the molecular formula C22H18BrF4O3PS
and a molecular weight of 549.32 g/mol. Its IUPAC name is [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid.
Molecular Properties
| Compound Name | [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid |
| PubChem CID | 10143920 |
| Molecular Formula | C22H18BrF4O3PS |
| Molecular Weight | 549.32 g/mol |
| Exact Mass | 547.98 |
| IUPAC Name | [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc(CSC(Cc2ccc(F)cc2)c2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C22H18BrF4O3PS/c23-20-11-15(3-10-19(20)22(26,27)31(28,29)30)13-32-21(16-4-8-18(25)9-5-16)12-14-1-6-17(24)7-2-14/h1-11,21H,12-13H2,(H2,28,29,30) |
| InChIKey | WTFNZBUIHYUWEX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 549.32 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid?
The IUPAC name of [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid (CID 10143920) is [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid.
What is the SMILES notation for [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid?
The canonical SMILES for [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid is O=P(O)(O)C(F)(F)c1ccc(CSC(Cc2ccc(F)cc2)c2ccc(F)cc2)cc1Br.
What is the InChIKey of [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid?
The InChIKey is WTFNZBUIHYUWEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18BrF4O3PS/c23-20-11-15(3-10-19(20)22(26,27)31(28,29)30)13-32-21(16-4-8-18(25)9-5-16)12-14-1-6-17(24)7-2-14/h1-11,21H,12-13H2,(H2,28,29,30).
What are the key properties of [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid?
[[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid has a molecular weight of 549.32 g/mol, XLogP of 7.17, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-[1,2-bis(4-fluorophenyl)ethylsulfanylmethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid is sourced from PubChem (CID 10143920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).