C17H20F3NO4 — CID 101439601
methyl (E,5S,6R)-6-(4-methoxyphenyl)-5-methyl-6-[(2,2,2-trifluoroacetyl)amino]hex-3-enoate (PubChem CID 101439601) has the molecular formula C17H20F3NO4 and a molecular weight of 359.34 g/mol. Its IUPAC name is methyl (E,5S,6R)-6-(4-methoxyphenyl)-5-methyl-6-[(2,2,2-trifluoroacetyl)amino]hex-3-enoate.
| Compound Name | methyl (E,5S,6R)-6-(4-methoxyphenyl)-5-methyl-6-[(2,2,2-trifluoroacetyl)amino]hex-3-enoate |
|---|---|
| PubChem CID | 101439601 |
| Molecular Formula | C17H20F3NO4 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | methyl (E,5S,6R)-6-(4-methoxyphenyl)-5-methyl-6-[(2,2,2-trifluoroacetyl)amino]hex-3-enoate |
| SMILES | COC(=O)C/C=C/[C@H](C)[C@@H](NC(=O)C(F)(F)F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H20F3NO4/c1-11(5-4-6-14(22)25-3)15(21-16(23)17(18,19)20)12-7-9-13(24-2)10-8-12/h4-5,7-11,15H,6H2,1-3H3,(H,21,23)/b5-4+/t11-,15+/m0/s1 |
| InChIKey | WBEGQPPKSYCQJD-FSHPDSMFSA-N |
| XLogP | 3.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|