C22H24O10 — CID 101439777
2,4,6,7-tetraacetyl-4-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]spiro[4.4]non-7-ene-1,3,9-trione (PubChem CID 101439777) has the molecular formula C22H24O10 and a molecular weight of 448.42 g/mol. Its IUPAC name is 2,4,6,7-tetraacetyl-4-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]spiro[4.4]non-7-ene-1,3,9-trione.
| Compound Name | 2,4,6,7-tetraacetyl-4-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]spiro[4.4]non-7-ene-1,3,9-trione |
|---|---|
| PubChem CID | 101439777 |
| Molecular Formula | C22H24O10 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2,4,6,7-tetraacetyl-4-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]spiro[4.4]non-7-ene-1,3,9-trione |
| SMILES | CC(=O)C1=CC(=O)C2(C(=O)C(C(C)=O)C(=O)C2(C(C)=O)[C@H]2C[C@H](O)[C@@H](CO)O2)C1C(C)=O |
| InChI | InChI=1S/C22H24O10/c1-8(24)12-5-15(29)22(18(12)10(3)26)20(31)17(9(2)25)19(30)21(22,11(4)27)16-6-13(28)14(7-23)32-16/h5,13-14,16-18,23,28H,6-7H2,1-4H3/t13-,14+,16+,17?,18?,21?,22?/m0/s1 |
| InChIKey | DOKWFJULXFJWOB-SFTULVPBSA-N |
| XLogP | -1.28 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|