C28H54O5S — CID 101439981
(4S,5R,6R)-2,2-ditert-butyl-4-(tert-butylsulfinylmethyl)-6-(2-heptyl-1,3-dioxolan-2-yl)-5-methyl-1,3-dioxane (PubChem CID 101439981) has the molecular formula C28H54O5S and a molecular weight of 502.80 g/mol. Its IUPAC name is (4S,5R,6R)-2,2-ditert-butyl-4-(tert-butylsulfinylmethyl)-6-(2-heptyl-1,3-dioxolan-2-yl)-5-methyl-1,3-dioxane.
| Compound Name | (4S,5R,6R)-2,2-ditert-butyl-4-(tert-butylsulfinylmethyl)-6-(2-heptyl-1,3-dioxolan-2-yl)-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 101439981 |
| Molecular Formula | C28H54O5S |
| Molecular Weight | 502.80 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | (4S,5R,6R)-2,2-ditert-butyl-4-(tert-butylsulfinylmethyl)-6-(2-heptyl-1,3-dioxolan-2-yl)-5-methyl-1,3-dioxane |
| SMILES | CCCCCCCC1([C@@H]2OC(C(C)(C)C)(C(C)(C)C)O[C@H](CS(=O)C(C)(C)C)[C@@H]2C)OCCO1 |
| InChI | InChI=1S/C28H54O5S/c1-12-13-14-15-16-17-27(30-18-19-31-27)23-21(2)22(20-34(29)26(9,10)11)32-28(33-23,24(3,4)5)25(6,7)8/h21-23H,12-20H2,1-11H3/t21-,22+,23+,34?/m0/s1 |
| InChIKey | BJGFFDKHYHDMJY-HTFCNXJLSA-N |
| XLogP | 6.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.80 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|