C86H58N2O — CID 101440187
2,5-bis[4-(2,3,4,5,6-pentakis-phenylphenyl)phenyl]-1,3,4-oxadiazole (PubChem CID 101440187) has the molecular formula C86H58N2O and a molecular weight of 1135.42 g/mol. Its IUPAC name is 2,5-bis[4-(2,3,4,5,6-pentakis-phenylphenyl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2,5-bis[4-(2,3,4,5,6-pentakis-phenylphenyl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 101440187 |
| Molecular Formula | C86H58N2O |
| Molecular Weight | 1135.42 g/mol |
| Exact Mass | 1134.45 |
| IUPAC Name | 2,5-bis[4-(2,3,4,5,6-pentakis-phenylphenyl)phenyl]-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccc(-c4nnc(-c5ccc(-c6c(-c7ccccc7)c(-c7ccccc7)c(-c7ccccc7)c(-c7ccccc7)c6-c6ccccc6)cc5)o4)cc3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C86H58N2O/c1-11-31-59(32-12-1)73-75(61-35-15-3-16-36-61)79(65-43-23-7-24-44-65)83(80(66-45-25-8-26-46-66)76(73)62-37-17-4-18-38-62)69-51-55-71(56-52-69)85-87-88-86(89-85)72-57-53-70(54-58-72)84-81(67-47-27-9-28-48-67)77(63-39-19-5-20-40-63)74(60-33-13-2-14-34-60)78(64-41-21-6-22-42-64)82(84)68-49-29-10-30-50-68/h1-58H |
| InChIKey | MUOMFJIIFWZMIF-UHFFFAOYSA-N |
| XLogP | 23.41 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1135.42 |
| LogP ≤ 5 | 23.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |