C33H39N5O3 — CID 10144065
N-[1-amino-4-(4-hydroxyphenyl)-1-oxobutan-2-yl]-5-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]pentanamide (PubChem CID 10144065) has the molecular formula C33H39N5O3 and a molecular weight of 553.71 g/mol. Its IUPAC name is N-[1-amino-4-(4-hydroxyphenyl)-1-oxobutan-2-yl]-5-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]pentanamide.
| Compound Name | N-[1-amino-4-(4-hydroxyphenyl)-1-oxobutan-2-yl]-5-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]pentanamide |
|---|---|
| PubChem CID | 10144065 |
| Molecular Formula | C33H39N5O3 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | N-[1-amino-4-(4-hydroxyphenyl)-1-oxobutan-2-yl]-5-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]pentanamide |
| SMILES | CC(C)(C)c1ccc(-n2nc(-c3ccccn3)cc2CCCCC(=O)NC(CCc2ccc(O)cc2)C(N)=O)cc1 |
| InChI | InChI=1S/C33H39N5O3/c1-33(2,3)24-14-16-25(17-15-24)38-26(22-30(37-38)28-9-6-7-21-35-28)8-4-5-10-31(40)36-29(32(34)41)20-13-23-11-18-27(39)19-12-23/h6-7,9,11-12,14-19,21-22,29,39H,4-5,8,10,13,20H2,1-3H3,(H2,34,41)(H,36,40) |
| InChIKey | YMAIXRHYFHKRDL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|