About 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile
2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile (PubChem CID 101440699) has the molecular formula C20H40N2O2Si2
and a molecular weight of 396.72 g/mol. Its IUPAC name is 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile.
Molecular Properties
| Compound Name | 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile |
| PubChem CID | 101440699 |
| Molecular Formula | C20H40N2O2Si2 |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile |
| SMILES | CCC(C#N)(O[Si](CC)(CC)CC)C(C#N)(CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H40N2O2Si2/c1-9-19(17-21,23-25(11-3,12-4)13-5)20(10-2,18-22)24-26(14-6,15-7)16-8/h9-16H2,1-8H3 |
| InChIKey | DQMYEZMFGRFNCV-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile?
The IUPAC name of 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile (CID 101440699) is 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile.
What is the SMILES notation for 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile?
The canonical SMILES for 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile is CCC(C#N)(O[Si](CC)(CC)CC)C(C#N)(CC)O[Si](CC)(CC)CC.
What is the InChIKey of 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile?
The InChIKey is DQMYEZMFGRFNCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40N2O2Si2/c1-9-19(17-21,23-25(11-3,12-4)13-5)20(10-2,18-22)24-26(14-6,15-7)16-8/h9-16H2,1-8H3.
What are the key properties of 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile?
2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile has a molecular weight of 396.72 g/mol, XLogP of 6.37, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethyl-2,3-bis(triethylsilyloxy)butanedinitrile is sourced from PubChem (CID 101440699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).