C33H28F6N2O2S2 — CID 101440815
4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[[(1S)-1-phenylethyl]carbamoyl]thiophen-3-yl]cyclopenten-1-yl]-5-methyl-N-[(1S)-1-phenylethyl]thiophene-2-carboxamide (PubChem CID 101440815) has the molecular formula C33H28F6N2O2S2 and a molecular weight of 662.72 g/mol. Its IUPAC name is 4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[[(1S)-1-phenylethyl]carbamoyl]thiophen-3-yl]cyclopenten-1-yl]-5-methyl-N-[(1S)-1-phenylethyl]thiophene-2-carboxamide.
| Compound Name | 4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[[(1S)-1-phenylethyl]carbamoyl]thiophen-3-yl]cyclopenten-1-yl]-5-methyl-N-[(1S)-1-phenylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 101440815 |
| Molecular Formula | C33H28F6N2O2S2 |
| Molecular Weight | 662.72 g/mol |
| Exact Mass | 662.15 |
| IUPAC Name | 4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[[(1S)-1-phenylethyl]carbamoyl]thiophen-3-yl]cyclopenten-1-yl]-5-methyl-N-[(1S)-1-phenylethyl]thiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)N[C@@H](C)c2ccccc2)cc1C1=C(c2cc(C(=O)N[C@@H](C)c3ccccc3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C33H28F6N2O2S2/c1-17(21-11-7-5-8-12-21)40-29(42)25-15-23(19(3)44-25)27-28(32(36,37)33(38,39)31(27,34)35)24-16-26(45-20(24)4)30(43)41-18(2)22-13-9-6-10-14-22/h5-18H,1-4H3,(H,40,42)(H,41,43)/t17-,18-/m0/s1 |
| InChIKey | PHNJUWMCPVWEAK-ROUUACIJSA-N |
| XLogP | 9.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.72 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|