C30H37N5O2 — CID 101440852
2-[2-(2-aminoethylamino)ethyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 101440852) has the molecular formula C30H37N5O2 and a molecular weight of 499.66 g/mol. Its IUPAC name is 2-[2-(2-aminoethylamino)ethyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[2-(2-aminoethylamino)ethyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 101440852 |
| Molecular Formula | C30H37N5O2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 2-[2-(2-aminoethylamino)ethyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCNc1cc2c(cc1C)C1(c3cc(C)c(NCC)cc3O2)c2ccccc2C(=O)N1CCNCCN |
| InChI | InChI=1S/C30H37N5O2/c1-5-33-25-17-27-23(15-19(25)3)30(24-16-20(4)26(34-6-2)18-28(24)37-27)22-10-8-7-9-21(22)29(36)35(30)14-13-32-12-11-31/h7-10,15-18,32-34H,5-6,11-14,31H2,1-4H3 |
| InChIKey | VHPSRBHVTYYFEF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|