About 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one
5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one (PubChem CID 101441414) has the molecular formula C17H14N2OS
and a molecular weight of 294.38 g/mol. Its IUPAC name is 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one.
Molecular Properties
| Compound Name | 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one |
| PubChem CID | 101441414 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one |
| SMILES | CN1C(=O)c2c(c3ccccc3n2C)Sc2ccccc21 |
| InChI | InChI=1S/C17H14N2OS/c1-18-12-8-4-3-7-11(12)16-15(18)17(20)19(2)13-9-5-6-10-14(13)21-16/h3-10H,1-2H3 |
| InChIKey | XEINWEAQWBQTDQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one?
The IUPAC name of 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one (CID 101441414) is 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one.
What is the SMILES notation for 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one?
The canonical SMILES for 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one is CN1C(=O)c2c(c3ccccc3n2C)Sc2ccccc21.
What is the InChIKey of 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one?
The InChIKey is XEINWEAQWBQTDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2OS/c1-18-12-8-4-3-7-11(12)16-15(18)17(20)19(2)13-9-5-6-10-14(13)21-16/h3-10H,1-2H3.
What are the key properties of 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one?
5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one has a molecular weight of 294.38 g/mol, XLogP of 3.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethylindolo[3,2-b][1,5]benzothiazepin-6-one is sourced from PubChem (CID 101441414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).