About 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one
2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one (PubChem CID 101441522) has the molecular formula C7H7BrF2O2
and a molecular weight of 241.03 g/mol. Its IUPAC name is 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one |
| PubChem CID | 101441522 |
| Molecular Formula | C7H7BrF2O2 |
| Molecular Weight | 241.03 g/mol |
| Exact Mass | 239.96 |
| IUPAC Name | 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one |
| SMILES | O=C1OC(CCCBr)C(F)=C1F |
| InChI | InChI=1S/C7H7BrF2O2/c8-3-1-2-4-5(9)6(10)7(11)12-4/h4H,1-3H2 |
| InChIKey | YVXQQFMSPFJFKX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.03 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one?
The IUPAC name of 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one (CID 101441522) is 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one.
What is the SMILES notation for 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one?
The canonical SMILES for 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one is O=C1OC(CCCBr)C(F)=C1F.
What is the InChIKey of 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one?
The InChIKey is YVXQQFMSPFJFKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrF2O2/c8-3-1-2-4-5(9)6(10)7(11)12-4/h4H,1-3H2.
What are the key properties of 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one?
2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one has a molecular weight of 241.03 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromopropyl)-3,4-difluoro-2H-furan-5-one is sourced from PubChem (CID 101441522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).