C9H9FO2 — CID 101441523
2-fluoro-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 101441523) has the molecular formula C9H9FO2 and a molecular weight of 168.17 g/mol. Its IUPAC name is 2-fluoro-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | 2-fluoro-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 101441523 |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 2-fluoro-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | O=C1OCC2C3C=CC(C3)C12F |
| InChI | InChI=1S/C9H9FO2/c10-9-6-2-1-5(3-6)7(9)4-12-8(9)11/h1-2,5-7H,3-4H2 |
| InChIKey | RGRVZVRJMUDCFF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|