C16H15ClN2O3S — CID 1014420
2-(4-chlorophenoxy)-N-[[3-(hydroxymethyl)phenyl]carbamothioyl]acetamide (PubChem CID 1014420) has the molecular formula C16H15ClN2O3S and a molecular weight of 350.83 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[[3-(hydroxymethyl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[[3-(hydroxymethyl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 1014420 |
| Molecular Formula | C16H15ClN2O3S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[[3-(hydroxymethyl)phenyl]carbamothioyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NC(=S)Nc1cccc(CO)c1 |
| InChI | InChI=1S/C16H15ClN2O3S/c17-12-4-6-14(7-5-12)22-10-15(21)19-16(23)18-13-3-1-2-11(8-13)9-20/h1-8,20H,9-10H2,(H2,18,19,21,23) |
| InChIKey | BMMGOEDCTKCMSN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|