C22H32O4 — CID 101442634
[(2R,3R,5S,8E,12S,13S,14S)-2-hydroxy-5,9,12,13-tetramethyl-16-methylidene-4-oxatricyclo[10.3.1.03,5]hexadeca-1(15),8-dien-14-yl] acetate (PubChem CID 101442634) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(2R,3R,5S,8E,12S,13S,14S)-2-hydroxy-5,9,12,13-tetramethyl-16-methylidene-4-oxatricyclo[10.3.1.03,5]hexadeca-1(15),8-dien-14-yl] acetate.
| Compound Name | [(2R,3R,5S,8E,12S,13S,14S)-2-hydroxy-5,9,12,13-tetramethyl-16-methylidene-4-oxatricyclo[10.3.1.03,5]hexadeca-1(15),8-dien-14-yl] acetate |
|---|---|
| PubChem CID | 101442634 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(2R,3R,5S,8E,12S,13S,14S)-2-hydroxy-5,9,12,13-tetramethyl-16-methylidene-4-oxatricyclo[10.3.1.03,5]hexadeca-1(15),8-dien-14-yl] acetate |
| SMILES | C=C1C2=C[C@H](OC(C)=O)[C@@H](C)[C@]1(C)CC/C(C)=C/CC[C@]1(C)O[C@@H]1[C@@H]2O |
| InChI | InChI=1S/C22H32O4/c1-13-8-7-10-22(6)20(26-22)19(24)17-12-18(25-16(4)23)15(3)21(5,11-9-13)14(17)2/h8,12,15,18-20,24H,2,7,9-11H2,1,3-6H3/b13-8+/t15-,18+,19-,20-,21-,22+/m1/s1 |
| InChIKey | HGSNNMBBSUAMEL-RJSTYANVSA-N |
| XLogP | 4.10 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|