C28H28F7NO3 — CID 10144277
3-[3-(3-tert-butylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 10144277) has the molecular formula C28H28F7NO3 and a molecular weight of 559.52 g/mol. Its IUPAC name is 3-[3-(3-tert-butylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[3-(3-tert-butylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 10144277 |
| Molecular Formula | C28H28F7NO3 |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 3-[3-(3-tert-butylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(C)(C)c1cccc(Oc2cccc(N(Cc3cccc(OC(F)(F)C(F)F)c3)CC(O)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C28H28F7NO3/c1-26(2,3)19-8-5-10-21(14-19)38-22-11-6-9-20(15-22)36(17-24(37)27(31,32)33)16-18-7-4-12-23(13-18)39-28(34,35)25(29)30/h4-15,24-25,37H,16-17H2,1-3H3 |
| InChIKey | KBCYRJMHJBESOS-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|