C11H13N4- — CID 101443179
N,N-dimethyl-3-(1,2,4-triazol-1-ylmethyl)benzene-2-id-1-amine (PubChem CID 101443179) has the molecular formula C11H13N4- and a molecular weight of 201.25 g/mol. Its IUPAC name is N,N-dimethyl-3-(1,2,4-triazol-1-ylmethyl)benzene-2-id-1-amine.
| Compound Name | N,N-dimethyl-3-(1,2,4-triazol-1-ylmethyl)benzene-2-id-1-amine |
|---|---|
| PubChem CID | 101443179 |
| Molecular Formula | C11H13N4- |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | N,N-dimethyl-3-(1,2,4-triazol-1-ylmethyl)benzene-2-id-1-amine |
| SMILES | CN(C)c1[c-]c(Cn2cncn2)ccc1 |
| InChI | InChI=1S/C11H13N4/c1-14(2)11-5-3-4-10(6-11)7-15-9-12-8-13-15/h3-5,8-9H,7H2,1-2H3/q-1 |
| InChIKey | HLUDSRBOPQERBU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|