C15H24O5 — CID 101443190
5-[3,3-dimethoxy-2-(methoxymethyl)cyclobuten-1-yl]-2,2-dimethyl-4,7-dihydro-1,3-dioxepine (PubChem CID 101443190) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 5-[3,3-dimethoxy-2-(methoxymethyl)cyclobuten-1-yl]-2,2-dimethyl-4,7-dihydro-1,3-dioxepine.
| Compound Name | 5-[3,3-dimethoxy-2-(methoxymethyl)cyclobuten-1-yl]-2,2-dimethyl-4,7-dihydro-1,3-dioxepine |
|---|---|
| PubChem CID | 101443190 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 5-[3,3-dimethoxy-2-(methoxymethyl)cyclobuten-1-yl]-2,2-dimethyl-4,7-dihydro-1,3-dioxepine |
| SMILES | COCC1=C(C2=CCOC(C)(C)OC2)CC1(OC)OC |
| InChI | InChI=1S/C15H24O5/c1-14(2)19-7-6-11(9-20-14)12-8-15(17-4,18-5)13(12)10-16-3/h6H,7-10H2,1-5H3 |
| InChIKey | RAXZZGKBDFHUAO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|