C19H38O2Si — CID 101443254
trimethyl-[(1E)-1-[(2-methylpropan-2-yl)oxy]dodeca-1,11-dienoxy]silane (PubChem CID 101443254) has the molecular formula C19H38O2Si and a molecular weight of 326.60 g/mol. Its IUPAC name is trimethyl-[(1E)-1-[(2-methylpropan-2-yl)oxy]dodeca-1,11-dienoxy]silane.
| Compound Name | trimethyl-[(1E)-1-[(2-methylpropan-2-yl)oxy]dodeca-1,11-dienoxy]silane |
|---|---|
| PubChem CID | 101443254 |
| Molecular Formula | C19H38O2Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | trimethyl-[(1E)-1-[(2-methylpropan-2-yl)oxy]dodeca-1,11-dienoxy]silane |
| SMILES | C=CCCCCCCCC/C=C(\OC(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H38O2Si/c1-8-9-10-11-12-13-14-15-16-17-18(20-19(2,3)4)21-22(5,6)7/h8,17H,1,9-16H2,2-7H3/b18-17+ |
| InChIKey | UKTTXSFCMZOHNJ-ISLYRVAYSA-N |
| XLogP | 6.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|