C19H15BrN6O2 — CID 101443546
[2-[2-(4-bromo-1-methylindol-3-yl)ethoxy]-1-(6-diazonioiminocyclohexa-2,4-dien-1-ylidene)-2-oxoethyl]iminoazanide (PubChem CID 101443546) has the molecular formula C19H15BrN6O2 and a molecular weight of 439.27 g/mol. Its IUPAC name is [2-[2-(4-bromo-1-methylindol-3-yl)ethoxy]-1-(6-diazonioiminocyclohexa-2,4-dien-1-ylidene)-2-oxoethyl]iminoazanide.
| Compound Name | [2-[2-(4-bromo-1-methylindol-3-yl)ethoxy]-1-(6-diazonioiminocyclohexa-2,4-dien-1-ylidene)-2-oxoethyl]iminoazanide |
|---|---|
| PubChem CID | 101443546 |
| Molecular Formula | C19H15BrN6O2 |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | [2-[2-(4-bromo-1-methylindol-3-yl)ethoxy]-1-(6-diazonioiminocyclohexa-2,4-dien-1-ylidene)-2-oxoethyl]iminoazanide |
| SMILES | Cn1cc(CCOC(=O)C(N=[N-])=C2C=CC=CC2=N[N+]#N)c2c(Br)cccc21 |
| InChI | InChI=1S/C19H15BrN6O2/c1-26-11-12(17-14(20)6-4-8-16(17)26)9-10-28-19(27)18(23-21)13-5-2-3-7-15(13)24-25-22/h2-8,11H,9-10H2,1H3 |
| InChIKey | NZCMAUOVJJNXAC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 106.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|