C24H21BrN2O5 — CID 101443550
methyl (1S,6R,14S)-20-bromo-15-methyl-4,5-dioxo-6-(2-oxoethyl)-13,15-diazapentacyclo[12.7.0.01,6.07,12.016,21]henicosa-7,9,11,16(21),17,19-hexaene-13-carboxylate (PubChem CID 101443550) has the molecular formula C24H21BrN2O5 and a molecular weight of 497.35 g/mol. Its IUPAC name is methyl (1S,6R,14S)-20-bromo-15-methyl-4,5-dioxo-6-(2-oxoethyl)-13,15-diazapentacyclo[12.7.0.01,6.07,12.016,21]henicosa-7,9,11,16(21),17,19-hexaene-13-carboxylate.
| Compound Name | methyl (1S,6R,14S)-20-bromo-15-methyl-4,5-dioxo-6-(2-oxoethyl)-13,15-diazapentacyclo[12.7.0.01,6.07,12.016,21]henicosa-7,9,11,16(21),17,19-hexaene-13-carboxylate |
|---|---|
| PubChem CID | 101443550 |
| Molecular Formula | C24H21BrN2O5 |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | methyl (1S,6R,14S)-20-bromo-15-methyl-4,5-dioxo-6-(2-oxoethyl)-13,15-diazapentacyclo[12.7.0.01,6.07,12.016,21]henicosa-7,9,11,16(21),17,19-hexaene-13-carboxylate |
| SMILES | COC(=O)N1c2ccccc2[C@@]2(CC=O)C(=O)C(=O)CC[C@@]23c2c(Br)cccc2N(C)[C@@H]13 |
| InChI | InChI=1S/C24H21BrN2O5/c1-26-17-9-5-7-15(25)19(17)24-11-10-18(29)20(30)23(24,12-13-28)14-6-3-4-8-16(14)27(21(24)26)22(31)32-2/h3-9,13,21H,10-12H2,1-2H3/t21-,23-,24-/m0/s1 |
| InChIKey | KVXUDBFKRGJIOB-XWGVYQGASA-N |
| XLogP | 3.51 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|