C16H22ClNO3 — CID 101443573
tert-butyl (2S)-2-[(2-chloro-3-phenylpropanoyl)amino]propanoate (PubChem CID 101443573) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-chloro-3-phenylpropanoyl)amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[(2-chloro-3-phenylpropanoyl)amino]propanoate |
|---|---|
| PubChem CID | 101443573 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | tert-butyl (2S)-2-[(2-chloro-3-phenylpropanoyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)C(Cl)Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22ClNO3/c1-11(15(20)21-16(2,3)4)18-14(19)13(17)10-12-8-6-5-7-9-12/h5-9,11,13H,10H2,1-4H3,(H,18,19)/t11-,13?/m0/s1 |
| InChIKey | YNODCBOTCKOEIG-AMGKYWFPSA-N |
| XLogP | 2.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|