C28H27N3O4S3 — CID 10144463
4-methylbenzenesulfonate;(2Z,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 10144463) has the molecular formula C28H27N3O4S3 and a molecular weight of 565.74 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;(2Z,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 4-methylbenzenesulfonate;(2Z,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10144463 |
| Molecular Formula | C28H27N3O4S3 |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 4-methylbenzenesulfonate;(2Z,5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCn1c(=O)/c(=C2\Sc3ccccc3N2C)s/c1=C\c1cccc[n+]1C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N3OS2.C7H8O3S/c1-4-12-24-18(14-15-9-7-8-13-22(15)2)27-19(20(24)25)21-23(3)16-10-5-6-11-17(16)26-21;1-6-2-4-7(5-3-6)11(8,9)10/h4-11,13-14H,1,12H2,2-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1/b21-19+; |
| InChIKey | USSGFDRATGCBHJ-UXJRWBAGSA-M |
| XLogP | 2.96 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|