About methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate
methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate (PubChem CID 101445210) has the molecular formula C14H17IO6
and a molecular weight of 408.19 g/mol. Its IUPAC name is methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate |
| PubChem CID | 101445210 |
| Molecular Formula | C14H17IO6 |
| Molecular Weight | 408.19 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate |
| SMILES | COC(=O)[C@H](C)c1ccccc1I(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C14H17IO6/c1-9(14(18)19-4)12-7-5-6-8-13(12)15(20-10(2)16)21-11(3)17/h5-9H,1-4H3/t9-/m1/s1 |
| InChIKey | VERCEWDOZKPAFW-SECBINFHSA-N |
| XLogP | 2.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate?
The IUPAC name of methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate (CID 101445210) is methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate.
What is the SMILES notation for methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate?
The canonical SMILES for methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate is COC(=O)[C@H](C)c1ccccc1I(OC(C)=O)OC(C)=O.
What is the InChIKey of methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate?
The InChIKey is VERCEWDOZKPAFW-SECBINFHSA-N. The full InChI is InChI=1S/C14H17IO6/c1-9(14(18)19-4)12-7-5-6-8-13(12)15(20-10(2)16)21-11(3)17/h5-9H,1-4H3/t9-/m1/s1.
What are the key properties of methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate?
methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate has a molecular weight of 408.19 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[2-(diacetyloxy-λ3-iodanyl)phenyl]propanoate is sourced from PubChem (CID 101445210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).