C17H13BN2O4 — CID 101445438
(E)-3-(1,3,2-benzodioxaborol-2-yloxy)-1,3-bis(1H-pyrrol-2-yl)prop-2-en-1-one (PubChem CID 101445438) has the molecular formula C17H13BN2O4 and a molecular weight of 320.11 g/mol. Its IUPAC name is (E)-3-(1,3,2-benzodioxaborol-2-yloxy)-1,3-bis(1H-pyrrol-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,3,2-benzodioxaborol-2-yloxy)-1,3-bis(1H-pyrrol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 101445438 |
| Molecular Formula | C17H13BN2O4 |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (E)-3-(1,3,2-benzodioxaborol-2-yloxy)-1,3-bis(1H-pyrrol-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C(/OB1Oc2ccccc2O1)c1ccc[nH]1)c1ccc[nH]1 |
| InChI | InChI=1S/C17H13BN2O4/c21-14(12-5-3-9-19-12)11-17(13-6-4-10-20-13)24-18-22-15-7-1-2-8-16(15)23-18/h1-11,19-20H/b17-11+ |
| InChIKey | KPWWBRSUYHDMLJ-GZTJUZNOSA-N |
| XLogP | 3.04 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|