About [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide
[tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide (PubChem CID 101445672) has the molecular formula C27H50PSi2-
and a molecular weight of 461.84 g/mol. Its IUPAC name is [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide.
Molecular Properties
| Compound Name | [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide |
| PubChem CID | 101445672 |
| Molecular Formula | C27H50PSi2- |
| Molecular Weight | 461.84 g/mol |
| Exact Mass | 461.32 |
| IUPAC Name | [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide |
| SMILES | CC(C)c1cc(C(C)C)c([Si](=[P-])[Si](C(C)(C)C)(C(C)(C)C)C(C)(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C27H50PSi2/c1-18(2)21-16-22(19(3)4)24(23(17-21)20(5)6)29(28)30(25(7,8)9,26(10,11)12)27(13,14)15/h16-20H,1-15H3/q-1 |
| InChIKey | CTWQIVRENGQGJH-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.84 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide?
The IUPAC name of [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide (CID 101445672) is [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide.
What is the SMILES notation for [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide?
The canonical SMILES for [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide is CC(C)c1cc(C(C)C)c([Si](=[P-])[Si](C(C)(C)C)(C(C)(C)C)C(C)(C)C)c(C(C)C)c1.
What is the InChIKey of [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide?
The InChIKey is CTWQIVRENGQGJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H50PSi2/c1-18(2)21-16-22(19(3)4)24(23(17-21)20(5)6)29(28)30(25(7,8)9,26(10,11)12)27(13,14)15/h16-20H,1-15H3/q-1.
What are the key properties of [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide?
[tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide has a molecular weight of 461.84 g/mol, XLogP of 9.59, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [tritert-butylsilyl-[2,4,6-tri(propan-2-yl)phenyl]silylidene]phosphanide is sourced from PubChem (CID 101445672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).