C15H26O2S2 — CID 101445752
(5S)-6-hydroxy-5-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]hexan-3-one (PubChem CID 101445752) has the molecular formula C15H26O2S2 and a molecular weight of 302.50 g/mol. Its IUPAC name is (5S)-6-hydroxy-5-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]hexan-3-one.
| Compound Name | (5S)-6-hydroxy-5-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]hexan-3-one |
|---|---|
| PubChem CID | 101445752 |
| Molecular Formula | C15H26O2S2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (5S)-6-hydroxy-5-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]hexan-3-one |
| SMILES | CC(C)=CC1(CCC(=O)C[C@H](C)CO)SCCCS1 |
| InChI | InChI=1S/C15H26O2S2/c1-12(2)10-15(18-7-4-8-19-15)6-5-14(17)9-13(3)11-16/h10,13,16H,4-9,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | GUFVXEZHAUDSGK-ZDUSSCGKSA-N |
| XLogP | 3.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|