C32H30N12O2 — CID 101446014
1-[2-[[3-ethynyl-5-[2,2,2-tri(pyrazol-1-yl)ethoxymethyl]phenyl]methoxy]-1,1-di(pyrazol-1-yl)ethyl]pyrazole (PubChem CID 101446014) has the molecular formula C32H30N12O2 and a molecular weight of 614.67 g/mol. Its IUPAC name is 1-[2-[[3-ethynyl-5-[2,2,2-tri(pyrazol-1-yl)ethoxymethyl]phenyl]methoxy]-1,1-di(pyrazol-1-yl)ethyl]pyrazole.
| Compound Name | 1-[2-[[3-ethynyl-5-[2,2,2-tri(pyrazol-1-yl)ethoxymethyl]phenyl]methoxy]-1,1-di(pyrazol-1-yl)ethyl]pyrazole |
|---|---|
| PubChem CID | 101446014 |
| Molecular Formula | C32H30N12O2 |
| Molecular Weight | 614.67 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 1-[2-[[3-ethynyl-5-[2,2,2-tri(pyrazol-1-yl)ethoxymethyl]phenyl]methoxy]-1,1-di(pyrazol-1-yl)ethyl]pyrazole |
| SMILES | C#Cc1cc(COCC(n2cccn2)(n2cccn2)n2cccn2)cc(COCC(n2cccn2)(n2cccn2)n2cccn2)c1 |
| InChI | InChI=1S/C32H30N12O2/c1-2-28-21-29(24-45-26-31(39-15-3-9-33-39,40-16-4-10-34-40)41-17-5-11-35-41)23-30(22-28)25-46-27-32(42-18-6-12-36-42,43-19-7-13-37-43)44-20-8-14-38-44/h1,3-23H,24-27H2 |
| InChIKey | PRALIJBMPTVHAX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 125.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.67 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|