C18H36OS2Si — CID 101446445
tert-butyl-[8-(1,3-dithian-2-yl)oct-1-en-3-yloxy]-dimethylsilane (PubChem CID 101446445) has the molecular formula C18H36OS2Si and a molecular weight of 360.71 g/mol. Its IUPAC name is tert-butyl-[8-(1,3-dithian-2-yl)oct-1-en-3-yloxy]-dimethylsilane.
| Compound Name | tert-butyl-[8-(1,3-dithian-2-yl)oct-1-en-3-yloxy]-dimethylsilane |
|---|---|
| PubChem CID | 101446445 |
| Molecular Formula | C18H36OS2Si |
| Molecular Weight | 360.71 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | tert-butyl-[8-(1,3-dithian-2-yl)oct-1-en-3-yloxy]-dimethylsilane |
| SMILES | C=CC(CCCCCC1SCCCS1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36OS2Si/c1-7-16(19-22(5,6)18(2,3)4)12-9-8-10-13-17-20-14-11-15-21-17/h7,16-17H,1,8-15H2,2-6H3 |
| InChIKey | HKXUAUVGHRMFFT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|