About 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one
3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one (PubChem CID 101446725) has the molecular formula C17H16ClN3O3S
and a molecular weight of 377.85 g/mol. Its IUPAC name is 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one.
Molecular Properties
| Compound Name | 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one |
| PubChem CID | 101446725 |
| Molecular Formula | C17H16ClN3O3S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one |
| SMILES | NC1=NNC(=O)C1C(CS(=O)(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN3O3S/c18-12-8-6-11(7-9-12)14(15-16(19)20-21-17(15)22)10-25(23,24)13-4-2-1-3-5-13/h1-9,14-15H,10H2,(H2,19,20)(H,21,22) |
| InChIKey | YUYSOXUXLXORKI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one?
The IUPAC name of 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one (CID 101446725) is 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one.
What is the SMILES notation for 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one?
The canonical SMILES for 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one is NC1=NNC(=O)C1C(CS(=O)(=O)c1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one?
The InChIKey is YUYSOXUXLXORKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3O3S/c18-12-8-6-11(7-9-12)14(15-16(19)20-21-17(15)22)10-25(23,24)13-4-2-1-3-5-13/h1-9,14-15H,10H2,(H2,19,20)(H,21,22).
What are the key properties of 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one?
3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one has a molecular weight of 377.85 g/mol, XLogP of 1.92, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[2-(benzenesulfonyl)-1-(4-chlorophenyl)ethyl]-1,4-dihydropyrazol-5-one is sourced from PubChem (CID 101446725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).