C33H36O4S4 — CID 101447322
1-[5-[10'-(5-heptanoylthiophen-2-yl)spiro[1,3-dioxolane-2,7'-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene]-4'-yl]thiophen-2-yl]heptan-1-one (PubChem CID 101447322) has the molecular formula C33H36O4S4 and a molecular weight of 624.91 g/mol. Its IUPAC name is 1-[5-[10'-(5-heptanoylthiophen-2-yl)spiro[1,3-dioxolane-2,7'-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene]-4'-yl]thiophen-2-yl]heptan-1-one.
| Compound Name | 1-[5-[10'-(5-heptanoylthiophen-2-yl)spiro[1,3-dioxolane-2,7'-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene]-4'-yl]thiophen-2-yl]heptan-1-one |
|---|---|
| PubChem CID | 101447322 |
| Molecular Formula | C33H36O4S4 |
| Molecular Weight | 624.91 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | 1-[5-[10'-(5-heptanoylthiophen-2-yl)spiro[1,3-dioxolane-2,7'-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene]-4'-yl]thiophen-2-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)c1ccc(-c2cc3c(s2)-c2sc(-c4ccc(C(=O)CCCCCC)s4)cc2C32OCCO2)s1 |
| InChI | InChI=1S/C33H36O4S4/c1-3-5-7-9-11-23(34)25-13-15-27(38-25)29-19-21-31(40-29)32-22(33(21)36-17-18-37-33)20-30(41-32)28-16-14-26(39-28)24(35)12-10-8-6-4-2/h13-16,19-20H,3-12,17-18H2,1-2H3 |
| InChIKey | UXHNIRQRPRJENF-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.91 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|