C26H34BrN5O5 — CID 10144752
5-(2-bromo-5-tert-butylphenoxy)-N-[2-[3-(dimethylamino)propylamino]-4,6-dimethoxypyrimidin-5-yl]furan-2-carboxamide (PubChem CID 10144752) has the molecular formula C26H34BrN5O5 and a molecular weight of 576.49 g/mol. Its IUPAC name is 5-(2-bromo-5-tert-butylphenoxy)-N-[2-[3-(dimethylamino)propylamino]-4,6-dimethoxypyrimidin-5-yl]furan-2-carboxamide.
| Compound Name | 5-(2-bromo-5-tert-butylphenoxy)-N-[2-[3-(dimethylamino)propylamino]-4,6-dimethoxypyrimidin-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 10144752 |
| Molecular Formula | C26H34BrN5O5 |
| Molecular Weight | 576.49 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | 5-(2-bromo-5-tert-butylphenoxy)-N-[2-[3-(dimethylamino)propylamino]-4,6-dimethoxypyrimidin-5-yl]furan-2-carboxamide |
| SMILES | COc1nc(NCCCN(C)C)nc(OC)c1NC(=O)c1ccc(Oc2cc(C(C)(C)C)ccc2Br)o1 |
| InChI | InChI=1S/C26H34BrN5O5/c1-26(2,3)16-9-10-17(27)19(15-16)37-20-12-11-18(36-20)22(33)29-21-23(34-6)30-25(31-24(21)35-7)28-13-8-14-32(4)5/h9-12,15H,8,13-14H2,1-7H3,(H,29,33)(H,28,30,31) |
| InChIKey | QOOFNZIBZMEXSK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|