C17H16BrNO2 — CID 101448693
(3aR,4R,9aS)-6-bromo-N-phenyl-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromen-4-amine (PubChem CID 101448693) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is (3aR,4R,9aS)-6-bromo-N-phenyl-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromen-4-amine.
| Compound Name | (3aR,4R,9aS)-6-bromo-N-phenyl-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromen-4-amine |
|---|---|
| PubChem CID | 101448693 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | (3aR,4R,9aS)-6-bromo-N-phenyl-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromen-4-amine |
| SMILES | Brc1ccc2c(c1)[C@H](Nc1ccccc1)[C@H]1CCO[C@H]1O2 |
| InChI | InChI=1S/C17H16BrNO2/c18-11-6-7-15-14(10-11)16(13-8-9-20-17(13)21-15)19-12-4-2-1-3-5-12/h1-7,10,13,16-17,19H,8-9H2/t13-,16-,17+/m1/s1 |
| InChIKey | SEWWAQUEIFNUKW-XYPHTWIQSA-N |
| XLogP | 4.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |