C13H14O5 — CID 101449343
(1S,3S,4R,6R,8S,9S,11R,12R)-8,11-dihydroxy-9-methyl-10-methylidene-5,13-dioxapentacyclo[7.4.0.01,12.03,8.04,6]tridecan-7-one (PubChem CID 101449343) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is (1S,3S,4R,6R,8S,9S,11R,12R)-8,11-dihydroxy-9-methyl-10-methylidene-5,13-dioxapentacyclo[7.4.0.01,12.03,8.04,6]tridecan-7-one.
| Compound Name | (1S,3S,4R,6R,8S,9S,11R,12R)-8,11-dihydroxy-9-methyl-10-methylidene-5,13-dioxapentacyclo[7.4.0.01,12.03,8.04,6]tridecan-7-one |
|---|---|
| PubChem CID | 101449343 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (1S,3S,4R,6R,8S,9S,11R,12R)-8,11-dihydroxy-9-methyl-10-methylidene-5,13-dioxapentacyclo[7.4.0.01,12.03,8.04,6]tridecan-7-one |
| SMILES | C=C1[C@@H](O)[C@H]2O[C@]23C[C@H]2[C@H]4O[C@H]4C(=O)[C@@]2(O)[C@]13C |
| InChI | InChI=1S/C13H14O5/c1-4-6(14)10-12(18-10)3-5-7-8(17-7)9(15)13(5,16)11(4,12)2/h5-8,10,14,16H,1,3H2,2H3/t5-,6+,7+,8+,10+,11+,12+,13+/m0/s1 |
| InChIKey | AFOLQKBEJOEDTO-JQFPRTPVSA-N |
| XLogP | -0.84 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|