About [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate
[4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate (PubChem CID 101450261) has the molecular formula C19H26O5
and a molecular weight of 334.41 g/mol. Its IUPAC name is [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate.
Molecular Properties
| Compound Name | [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate |
| PubChem CID | 101450261 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@H](/C=C/CCCCCCO)OC(C)=O)cc1 |
| InChI | InChI=1S/C19H26O5/c1-15(21)23-18-12-10-17(11-13-18)19(24-16(2)22)9-7-5-3-4-6-8-14-20/h7,9-13,19-20H,3-6,8,14H2,1-2H3/b9-7+/t19-/m0/s1 |
| InChIKey | DUAQHHKYPDQUFY-XSBJJCPUSA-N |
| XLogP | 3.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate?
The IUPAC name of [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate (CID 101450261) is [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate.
What is the SMILES notation for [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate?
The canonical SMILES for [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate is CC(=O)Oc1ccc([C@H](/C=C/CCCCCCO)OC(C)=O)cc1.
What is the InChIKey of [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate?
The InChIKey is DUAQHHKYPDQUFY-XSBJJCPUSA-N. The full InChI is InChI=1S/C19H26O5/c1-15(21)23-18-12-10-17(11-13-18)19(24-16(2)22)9-7-5-3-4-6-8-14-20/h7,9-13,19-20H,3-6,8,14H2,1-2H3/b9-7+/t19-/m0/s1.
What are the key properties of [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate?
[4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate has a molecular weight of 334.41 g/mol, XLogP of 3.72, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E,1S)-1-acetyloxy-9-hydroxynon-2-enyl]phenyl] acetate is sourced from PubChem (CID 101450261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).