C10H8Cl2F12N3O4P3 — CID 101450295
19,19-dichloro-3,3,4,4,5,5,13,13,14,14,15,15-dodecafluoro-1,7,11,17-tetraoxa-9,18,20-triaza-8λ5,10λ5,19λ5-triphosphadispiro[7.1.710.38]icosa-8,10(18),19-triene (PubChem CID 101450295) has the molecular formula C10H8Cl2F12N3O4P3 and a molecular weight of 625.99 g/mol. Its IUPAC name is 19,19-dichloro-3,3,4,4,5,5,13,13,14,14,15,15-dodecafluoro-1,7,11,17-tetraoxa-9,18,20-triaza-8λ5,10λ5,19λ5-triphosphadispiro[7.1.710.38]icosa-8,10(18),19-triene.
| Compound Name | 19,19-dichloro-3,3,4,4,5,5,13,13,14,14,15,15-dodecafluoro-1,7,11,17-tetraoxa-9,18,20-triaza-8λ5,10λ5,19λ5-triphosphadispiro[7.1.710.38]icosa-8,10(18),19-triene |
|---|---|
| PubChem CID | 101450295 |
| Molecular Formula | C10H8Cl2F12N3O4P3 |
| Molecular Weight | 625.99 g/mol |
| Exact Mass | 624.89 |
| IUPAC Name | 19,19-dichloro-3,3,4,4,5,5,13,13,14,14,15,15-dodecafluoro-1,7,11,17-tetraoxa-9,18,20-triaza-8λ5,10λ5,19λ5-triphosphadispiro[7.1.710.38]icosa-8,10(18),19-triene |
| SMILES | FC1(F)COP2(=NP(Cl)(Cl)=NP3(=N2)OCC(F)(F)C(F)(F)C(F)(F)CO3)OCC(F)(F)C1(F)F |
| InChI | InChI=1S/C10H8Cl2F12N3O4P3/c11-32(12)25-33(28-1-5(13,14)9(21,22)6(15,16)2-29-33)27-34(26-32)30-3-7(17,18)10(23,24)8(19,20)4-31-34/h1-4H2 |
| InChIKey | GKGYLZSUSKYRJB-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 74.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.99 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|