C19H16N2O4 — CID 101450331
3'-phenyl-1'-propylspiro[2-benzofuran-3,5'-imidazolidine]-1,2',4'-trione (PubChem CID 101450331) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3'-phenyl-1'-propylspiro[2-benzofuran-3,5'-imidazolidine]-1,2',4'-trione.
| Compound Name | 3'-phenyl-1'-propylspiro[2-benzofuran-3,5'-imidazolidine]-1,2',4'-trione |
|---|---|
| PubChem CID | 101450331 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3'-phenyl-1'-propylspiro[2-benzofuran-3,5'-imidazolidine]-1,2',4'-trione |
| SMILES | CCCN1C(=O)N(c2ccccc2)C(=O)C12OC(=O)c1ccccc12 |
| InChI | InChI=1S/C19H16N2O4/c1-2-12-20-18(24)21(13-8-4-3-5-9-13)17(23)19(20)15-11-7-6-10-14(15)16(22)25-19/h3-11H,2,12H2,1H3 |
| InChIKey | YUIPHWMFNMFZDJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|