C19H14F3NO5S3 — CID 101450417
(7-tert-butyl-1,3-dioxo-[1,4]benzodithiino[3,2-f]isoindol-2-yl) trifluoromethanesulfonate (PubChem CID 101450417) has the molecular formula C19H14F3NO5S3 and a molecular weight of 489.52 g/mol. Its IUPAC name is (7-tert-butyl-1,3-dioxo-[1,4]benzodithiino[3,2-f]isoindol-2-yl) trifluoromethanesulfonate.
| Compound Name | (7-tert-butyl-1,3-dioxo-[1,4]benzodithiino[3,2-f]isoindol-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101450417 |
| Molecular Formula | C19H14F3NO5S3 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | (7-tert-butyl-1,3-dioxo-[1,4]benzodithiino[3,2-f]isoindol-2-yl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccc2sc3cc4c(=O)n(OS(=O)(=O)C(F)(F)F)c(=O)c4cc3sc2c1 |
| InChI | InChI=1S/C19H14F3NO5S3/c1-18(2,3)9-4-5-12-13(6-9)30-15-8-11-10(7-14(15)29-12)16(24)23(17(11)25)28-31(26,27)19(20,21)22/h4-8H,1-3H3 |
| InChIKey | FJBCEBUFEBQOOP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|